CAS
92-10-4 Purity
---
92-10-4 Purity
---
Inquiry Basket
2-m-Tolylthiazole-5-carbaldehyde
CAS
921061-16-7
Catalog Number
ACM921061167
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-m-Tolylthiazole-5-carbaldehyde?
The molecular formula of 2-m-Tolylthiazole-5-carbaldehyde is C11H9NOS.
What is the molecular weight of 2-m-Tolylthiazole-5-carbaldehyde?
The molecular weight of 2-m-Tolylthiazole-5-carbaldehyde is 203.26 g/mol.
What is the IUPAC name of 2-m-Tolylthiazole-5-carbaldehyde?
The IUPAC name of 2-m-Tolylthiazole-5-carbaldehyde is 2-(3-methylphenyl)-1,3-thiazole-5-carbaldehyde.
What is the InChI of 2-m-Tolylthiazole-5-carbaldehyde?
The InChI of 2-m-Tolylthiazole-5-carbaldehyde is InChI=1S/C11H9NOS/c1-8-3-2-4-9(5-8)11-12-6-10(7-13)14-11/h2-7H,1H3.
What is the InChIKey of 2-m-Tolylthiazole-5-carbaldehyde?
The InChIKey of 2-m-Tolylthiazole-5-carbaldehyde is MQUFKDMUTLOWEC-UHFFFAOYSA-N.
What is the canonical SMILES of 2-m-Tolylthiazole-5-carbaldehyde?
The canonical SMILES of 2-m-Tolylthiazole-5-carbaldehyde is CC1=CC(=CC=C1)C2=NC=C(S2)C=O.
What is the CAS number of 2-m-Tolylthiazole-5-carbaldehyde?
The CAS number of 2-m-Tolylthiazole-5-carbaldehyde is 921061-16-7.
What is the hydrogen bond donor count of 2-m-Tolylthiazole-5-carbaldehyde?
The hydrogen bond donor count of 2-m-Tolylthiazole-5-carbaldehyde is 0.
What is the hydrogen bond acceptor count of 2-m-Tolylthiazole-5-carbaldehyde?
The hydrogen bond acceptor count of 2-m-Tolylthiazole-5-carbaldehyde is 3.
Is 2-m-Tolylthiazole-5-carbaldehyde a canonicalized compound?
Yes, 2-m-Tolylthiazole-5-carbaldehyde is a canonicalized compound.
Recommended Products
CAS
92105-56-1 Purity
96%
92105-56-1 Purity
96%
