CAS
921061-16-7 Purity
---
921061-16-7 Purity
---
Inquiry Basket
4-Phenyl-5-piperidin-1-yl-4H-1,2,4-triazole-3-thiol
CAS
92110-77-5
Catalog Number
ACM92110775
Category
Other Products
Molecular Formula
C13H16N4S
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C13H16N4S.
What is the molecular weight of the compound?
The molecular weight of the compound is 260.36 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-phenyl-3-piperidin-1-yl-1H-1,2,4-triazole-5-thione.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C13H16N4S/c18-13-15-14-12(16-9-5-2-6-10-16)17(13)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2,(H,15,18).
What is the CAS number of the compound?
The CAS number of the compound is 92110-77-5.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.4.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 2 rotatable bond counts.
Is the compound a canonicalized form?
Yes, the compound is in its canonicalized form.
Recommended Products
