CAS
917752-45-5 Purity
---
917752-45-5 Purity
---
Inquiry Basket
1-Boc-4-[(4-fluorophenyl)methyl]-4-(hydroxymethyl)-piperidine
CAS
917755-78-3
Catalog Number
ACM917755783
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C18H26FNO3.
What are the synonyms of the compound?
The synonyms of the compound are 917755-78-3, SCHEMBL3356420, JLJSLCJLESWFPT-UHFFFAOYSA-N, DTXSID201125809, 1-Boc-4-[(4-fluorophenyl)methyl]-4-(hydroxymethyl)-piperidine.
What is the molecular weight of the compound?
The molecular weight of the compound is 323.4 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is tert-butyl 4-[(4-fluorophenyl)methyl]-4-(hydroxymethyl)piperidine-1-carboxylate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C18H26FNO3/c1-17(2,3)23-16(22)20-10-8-18(13-21,9-11-20)12-14-4-6-15(19)7-5-14/h4-7,21H,8-13H2,1-3H3.
What is the InChIKey of the compound?
The InChIKey of the compound is JLJSLCJLESWFPT-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC(C)(C)OC(=O)N1CCC(CC1)(CC2=CC=C(C=C2)F)CO.
What is the CAS number of the compound?
The CAS number of the compound is 917755-78-3.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 3.1.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![3-Bromo-8-methoxyimidazo[1,2-a]pyrazine](https://resource.alfa-chemistry.com/structure/91775-62-1.gif)
