CAS
915920-26-2 Purity
---
915920-26-2 Purity
---
Inquiry Basket
Chembrdg-bb 4024376
CAS
915920-35-3
Catalog Number
ACM915920353
Category
Other Products
Molecular Formula
C12H15N3OS
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
CHEMBRDG-BB 4024376;5-[1-(4-ETHYLPHENOXY)ETHYL]-1,3,4-THIADIAZOL-2-AMINE
What is the molecular formula of Chembrdg-bb 4024376?
The molecular formula of Chembrdg-bb 4024376 is C12H15N3OS.
What is the molecular weight of Chembrdg-bb 4024376?
The molecular weight of Chembrdg-bb 4024376 is 249.33 g/mol.
How was the molecular weight computed?
The molecular weight was computed by PubChem 2.1 (PubChem release 2021.05.07).
What is the IUPAC name of Chembrdg-bb 4024376?
The IUPAC name of Chembrdg-bb 4024376 is 5-[1-(4-ethylphenoxy)ethyl]-1,3,4-thiadiazol-2-amine.
What is the InChI of Chembrdg-bb 4024376?
The InChI of Chembrdg-bb 4024376 is InChI=1S/C12H15N3OS/c1-3-9-4-6-10(7-5-9)16-8(2)11-14-15-12(13)17-11/h4-8H,3H2,1-2H3,(H2,13,15).
What is the InChIKey of Chembrdg-bb 4024376?
The InChIKey of Chembrdg-bb 4024376 is YNXINTUMCSZUOG-UHFFFAOYSA-N.
What is the canonical SMILES of Chembrdg-bb 4024376?
The canonical SMILES of Chembrdg-bb 4024376 is CCC1=CC=C(C=C1)OC(C)C2=NN=C(S2)N.
What is the CAS number of Chembrdg-bb 4024376?
The CAS number of Chembrdg-bb 4024376 is 915920-35-3.
How many hydrogen bond donor counts does Chembrdg-bb 4024376 have?
Chembrdg-bb 4024376 has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Chembrdg-bb 4024376 have?
Chembrdg-bb 4024376 has 5 hydrogen bond acceptor counts.
Recommended Products
