What is the molecular formula of Ethyl[2-methyl-3-(chlorosulfonyl)phenoxy]acetate?
The molecular formula is C11H13ClO5S.
When was Ethyl[2-methyl-3-(chlorosulfonyl)phenoxy]acetate created?
It was created on October 30, 2011.
What is the IUPAC name of Ethyl[2-methyl-3-(chlorosulfonyl)phenoxy]acetate?
The IUPAC name is ethyl 2-(3-chlorosulfonyl-2-methylphenoxy)acetate.
What is the InChI of Ethyl[2-methyl-3-(chlorosulfonyl)phenoxy]acetate?
The InChI is InChI=1S/C11H13ClO5S/c1-3-16-11(13)7-17-9-5-4-6-10(8(9)2)18(12,14)15/h4-6H,3,7H2,1-2H3.
What is the InChIKey of Ethyl[2-methyl-3-(chlorosulfonyl)phenoxy]acetate?
The InChIKey is BPYXVPOLVBLNQJ-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl[2-methyl-3-(chlorosulfonyl)phenoxy]acetate?
The canonical SMILES is CCOC(=O)COC1=C(C(=CC=C1)S(=O)(=O)Cl)C.
What is the molecular weight of Ethyl[2-methyl-3-(chlorosulfonyl)phenoxy]acetate?
The molecular weight is 292.74 g/mol.
What is the XLogP3-AA value of Ethyl[2-methyl-3-(chlorosulfonyl)phenoxy]acetate?
The XLogP3-AA value is 2.6.
How many hydrogen bond donor counts does Ethyl[2-methyl-3-(chlorosulfonyl)phenoxy]acetate have?
It has 0 hydrogen bond donor counts.
How many rotatable bond counts does Ethyl[2-methyl-3-(chlorosulfonyl)phenoxy]acetate have?
It has 6 rotatable bond counts.