CAS
91427-62-2 Purity
---
91427-62-2 Purity
---
Inquiry Basket
4-(4-Fluorophenyl)-2-methyl-1H-imidazole-5-carboxylic acid methyl ester
CAS
914288-11-2
Catalog Number
ACM914288112
Category
Other Products
Molecular Formula
C12H11FN2O2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is methyl 4-(4-fluorophenyl)-2-methyl-1H-imidazole-5-carboxylate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C12H11FN2O2/c1-7-14-10(11(15-7)12(16)17-2)8-3-5-9(13)6-4-8/h3-6H,1-2H3,(H,14,15).
What is the molecular weight of the compound?
The molecular weight of the compound is 234.23 g/mol.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.4.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 3 rotatable bond counts.
What is the exact mass of the compound?
The exact mass of the compound is 234.08045576 g/mol.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 55.2.
How many heavy atom counts does the compound have?
The compound has 17 heavy atom counts.
Recommended Products
![Ethyl[2-methyl-3-(chlorosulfonyl)phenoxy]acetate](https://resource.alfa-chemistry.com/structure/91427-62-2.gif)
CAS
914287-71-1 Purity
---
914287-71-1 Purity
---
