What is the molecular formula of Boronicacid, b-[3-[[(3-bromophenyl)sulfonyl]amino]phenyl]?
The molecular formula is C12H11BBrNO4S.
When was Boronicacid, b-[3-[[(3-bromophenyl)sulfonyl]amino]phenyl] created and modified in PubChem?
It was created on 2009-07-21 and modified on 2023-12-30.
What is the IUPAC Name of Boronicacid, b-[3-[[(3-bromophenyl)sulfonyl]amino]phenyl]?
The IUPAC Name is [3-[(3-bromophenyl)sulfonylamino]phenyl]boronic acid.
What is the Canonical SMILES representation of Boronicacid, b-[3-[[(3-bromophenyl)sulfonyl]amino]phenyl]?
The Canonical SMILES representation is B(C1=CC(=CC=C1)NS(=O)(=O)C2=CC(=CC=C2)Br)(O)O.
How many hydrogen bond donor counts are in Boronicacid, b-[3-[[(3-bromophenyl)sulfonyl]amino]phenyl]?
There are 3 hydrogen bond donor counts.
What is the exact mass of Boronicacid, b-[3-[[(3-bromophenyl)sulfonyl]amino]phenyl]?
The exact mass is 354.96852 g/mol.
How many rotatable bond counts are in Boronicacid, b-[3-[[(3-bromophenyl)sulfonyl]amino]phenyl]?
There are 4 rotatable bond counts.
What is the topological polar surface area of Boronicacid, b-[3-[[(3-bromophenyl)sulfonyl]amino]phenyl]?
The topological polar surface area is 95 Ų.
How many heavy atoms are there in Boronicacid, b-[3-[[(3-bromophenyl)sulfonyl]amino]phenyl]?
There are 20 heavy atoms.
Is Boronicacid, b-[3-[[(3-bromophenyl)sulfonyl]amino]phenyl] a canonicalized compound in PubChem?
Yes, the compound is canonicalized in PubChem.