What is the molecular formula of Boronicacid,b-[4-[[(3-hydroxypropyl)amino]carbonyl]phenyl]?
The molecular formula is C10H14BNO4.
When was Boronicacid,b-[4-[[(3-hydroxypropyl)amino]carbonyl]phenyl] created on PubChem?
It was created on July 21, 2009.
What is the IUPAC name of Boronicacid,b-[4-[[(3-hydroxypropyl)amino]carbonyl]phenyl]?
The IUPAC name is [4-(3-hydroxypropylcarbamoyl)phenyl]boronic acid.
What is the InChI of Boronicacid,b-[4-[[(3-hydroxypropyl)amino]carbonyl]phenyl]?
The InChI is InChI=1S/C10H14BNO4/c13-7-1-6-12-10(14)8-2-4-9(5-3-8)11(15)16/h2-5,13,15-16H,1,6-7H2,(H,12,14).
What is the Canonical SMILES of Boronicacid,b-[4-[[(3-hydroxypropyl)amino]carbonyl]phenyl]?
The Canonical SMILES is B(C1=CC=C(C=C1)C(=O)NCCCO)(O)O.
What is the molecular weight of Boronicacid,b-[4-[[(3-hydroxypropyl)amino]carbonyl]phenyl]?
The molecular weight is 223.04 g/mol.
How many hydrogen bond donor counts does Boronicacid,b-[4-[[(3-hydroxypropyl)amino]carbonyl]phenyl] have?
It has 4 hydrogen bond donor counts.
What is the exact mass of Boronicacid,b-[4-[[(3-hydroxypropyl)amino]carbonyl]phenyl]?
The exact mass is 223.1015881 g/mol.
Is the compound considered canonicalized on PubChem?
Yes, the compound is canonicalized on PubChem.
What is the topological polar surface area of Boronicacid,b-[4-[[(3-hydroxypropyl)amino]carbonyl]phenyl]?
The topological polar surface area is 89.8 Ų.