913322-48-2 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 4-(2-bromophenyl)-6-methylpyrimidin-2-amine.
The molecular weight of the compound is 264.12 g/mol.
The InChI of the compound is InChI=1S/C11H10BrN3/c1-7-6-10(15-11(13)14-7)8-4-2-3-5-9(8)12/h2-6H,1H3,(H2,13,14,15).
The InChIKey of the compound is HNXXKAQRFWRVNY-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC1=CC(=NC(=N1)N)C2=CC=CC=C2Br.
The CAS number of the compound is 913322-51-7.
The XLogP3 value of the compound is 2.2.
The compound has 1 hydrogen bond donor count.
The compound has 3 hydrogen bond acceptor counts.
The compound has 1 rotatable bond count.