CAS
91331-86-1 Purity
---
91331-86-1 Purity
---
Inquiry Basket
4-METHYL-6-(1,3-THIAZOL-2-YL)PYRIMIDIN-2-AMINE
CAS
913322-48-2
Catalog Number
ACM913322482
Category
Other Products
Molecular Weight
192.24092
Molecular Formula
C8H8N4S
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
4-METHYL-6-(1,3-THIAZOL-2-YL)PYRIMIDIN-2-AMINE
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-methyl-6-(1,3-thiazol-2-yl)pyrimidin-2-amine.
What is the molecular formula of the compound?
The molecular formula of the compound is C8H8N4S.
What is the molecular weight of the compound?
The molecular weight of the compound is 192.24 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H8N4S/c1-5-4-6(12-8(9)11-5)7-10-2-3-13-7/h2-4H,1H3,(H2,9,11,12).
What is the InChIKey of the compound?
The InChIKey of the compound is RNULSDNUWKDSSC-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is CC1=CC(=NC(=N1)N)C2=NC=CS2.
What is the CAS number of the compound?
The CAS number of the compound is 913322-48-2.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 1.
How many hydrogen bond donor and acceptor counts does the compound have?
The compound has 1 hydrogen bond donor count and 5 hydrogen bond acceptor counts.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 92.9 ?2.
Recommended Products
