CAS
913292-39-4 Purity
---
913292-39-4 Purity
---
Inquiry Basket
6-Isopropyl-2-methylbenzothiazole
CAS
91331-55-4
Catalog Number
ACM91331554
Category
Other Products
Molecular Weight
191.29262
Molecular Formula
C11H13NS
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
Benzothiazole, 6-isopropyl-2-methyl- (7CI)
What is the molecular formula of 6-Isopropyl-2-methylbenzothiazole?
The molecular formula of 6-Isopropyl-2-methylbenzothiazole is C11H13NS.
What is the molecular weight of 6-Isopropyl-2-methylbenzothiazole?
The molecular weight of 6-Isopropyl-2-methylbenzothiazole is 191.29 g/mol.
What is the IUPAC name of 6-Isopropyl-2-methylbenzothiazole?
The IUPAC name of 6-Isopropyl-2-methylbenzothiazole is 2-methyl-6-propan-2-yl-1,3-benzothiazole.
What is the InChIKey of 6-Isopropyl-2-methylbenzothiazole?
The InChIKey of 6-Isopropyl-2-methylbenzothiazole is VIYIYGNVHSOXKC-UHFFFAOYSA-N.
What is the Canonical SMILES of 6-Isopropyl-2-methylbenzothiazole?
The Canonical SMILES of 6-Isopropyl-2-methylbenzothiazole is CC1=NC2=C(S1)C=C(C=C2)C(C)C.
What is the XLogP3-AA value of 6-Isopropyl-2-methylbenzothiazole?
The XLogP3-AA value of 6-Isopropyl-2-methylbenzothiazole is 3.9.
How many hydrogen bond donor counts are there in 6-Isopropyl-2-methylbenzothiazole?
There are 0 hydrogen bond donor counts in 6-Isopropyl-2-methylbenzothiazole.
How many hydrogen bond acceptor counts are there in 6-Isopropyl-2-methylbenzothiazole?
There are 2 hydrogen bond acceptor counts in 6-Isopropyl-2-methylbenzothiazole.
What is the topological polar surface area of 6-Isopropyl-2-methylbenzothiazole?
The topological polar surface area of 6-Isopropyl-2-methylbenzothiazole is 41.1 Å.
Is the compound canonicalized in 6-Isopropyl-2-methylbenzothiazole?
Yes, the compound is canonicalized in 6-Isopropyl-2-methylbenzothiazole according to PubChem.
Recommended Products
![ACETAMIDE,N-[BIS[(ISOPROPYL)AMINO]METHYLENE]-](https://resource.alfa-chemistry.com/structure/913292-39-4.gif)
