CAS
91324-41-3 Purity
---
91324-41-3 Purity
---
![5-Heptenoicacid,7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]-,1-methylethyl ester,(5E)-](https://resource.alfa-chemistry.com/structure/913258-34-1.gif)
Inquiry Basket
ACETAMIDE,N-[BIS[(ISOPROPYL)AMINO]METHYLENE]-
CAS
913292-39-4
Catalog Number
ACM913292394
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is N-[N,N'-di(propan-2-yl)carbamimidoyl]acetamide.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C9H19N3O/c1-6(2)10-9(11-7(3)4)12-8(5)13/h6-7H,1-5H3,(H2,10,11,12,13).
What is the InChIKey of the compound?
The InChIKey of the compound is LSQTVUGYSQRCJI-UHFFFAOYSA-N.
What is the canonical SMILES representation of the compound?
The canonical SMILES representation of the compound is CC(C)NC(=NC(C)C)NC(=O)C.
What is the molecular weight of the compound?
The molecular weight of the compound is 185.27 g/mol.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 1.4.
How many hydrogen bond donor counts are there in the compound?
There are 2 hydrogen bond donor counts in the compound.
How many hydrogen bond acceptor counts are there in the compound?
There are 2 hydrogen bond acceptor counts in the compound.
How many rotatable bond counts are there in the compound?
There are 4 rotatable bond counts in the compound.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 53.5 Ų.
Recommended Products
