What is the molecular formula of Isoxazolo[5,4-c]pyridin-3(2H)-one, 4,5,6,7-tetrahydro-7-methyl-(9ci)?
The molecular formula is C7H10N2O2.
What is the molecular weight of Isoxazolo[5,4-c]pyridin-3(2H)-one, 4,5,6,7-tetrahydro-7-methyl-(9ci)?
The molecular weight is 154.17 g/mol.
What is the IUPAC name of Isoxazolo[5,4-c]pyridin-3(2H)-one, 4,5,6,7-tetrahydro-7-methyl-(9ci)?
The IUPAC name is 7-methyl-4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-one.
What is the InChI of Isoxazolo[5,4-c]pyridin-3(2H)-one, 4,5,6,7-tetrahydro-7-methyl-(9ci)?
The InChI is InChI=1S/C7H10N2O2/c1-4-6-5(2-3-8-4)7(10)9-11-6/h4,8H,2-3H2,1H3,(H,9,10).
What is the InChIKey of Isoxazolo[5,4-c]pyridin-3(2H)-one, 4,5,6,7-tetrahydro-7-methyl-(9ci)?
The InChIKey is RYLYKHOOXLZCPM-UHFFFAOYSA-N.
How many hydrogen bond donor counts does Isoxazolo[5,4-c]pyridin-3(2H)-one, 4,5,6,7-tetrahydro-7-methyl-(9ci) have?
It has 2 hydrogen bond donor counts.
What is the XLogP3-AA value of Isoxazolo[5,4-c]pyridin-3(2H)-one, 4,5,6,7-tetrahydro-7-methyl-(9ci)?
The XLogP3-AA value is -0.5.
What is the topological polar surface area of Isoxazolo[5,4-c]pyridin-3(2H)-one, 4,5,6,7-tetrahydro-7-methyl-(9ci)?
The topological polar surface area is 50.4 Ų.
How many rotatable bond counts does Isoxazolo[5,4-c]pyridin-3(2H)-one, 4,5,6,7-tetrahydro-7-methyl-(9ci) have?
It has 0 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized according to PubChem.