91305-30-5 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C15H20BN3O2.
The molecular weight of the compound is 285.15 g/mol.
The IUPAC name of the compound is N-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-2-amine.
The InChI of the compound is InChI=1S/C15H20BN3O2/c1-14(2)15(3,4)21-16(20-14)11-6-7-12-10(8-11)9-18-13(17-5)19-12/h6-9H,1-5H3,(H,17,18,19).
The InChIKey of the compound is DIHAVMAMDKOAGT-UHFFFAOYSA-N.
The Canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=CC3=CN=C(N=C3C=C2)NC.
The compound has 1 hydrogen bond donor count.
The topological polar surface area of the compound is 56.3 Ų.
Yes, the compound is canonicalized.
The complexity of the compound is 375.