What is the molecular formula of Acetamide, N-(2-(((aminocarbonyl)oxy)methyl)-1-methyl-1H-imidazol-5-yl)-?
The molecular formula is C8H12N4O3.
When was the PubChem CID for Acetamide, N-(2-(((aminocarbonyl)oxy)methyl)-1-methyl-1H-imidazol-5-yl)- created?
The PubChem CID was created on 2005-08-08.
What is the IUPAC name of Acetamide, N-(2-(((aminocarbonyl)oxy)methyl)-1-methyl-1H-imidazol-5-yl)-?
The IUPAC name is (5-acetamido-1-methylimidazol-2-yl)methyl carbamate.
What is the InChIKey of Acetamide, N-(2-(((aminocarbonyl)oxy)methyl)-1-methyl-1H-imidazol-5-yl)-?
The InChIKey is OHXCEWNVKPDFRY-UHFFFAOYSA-N.
What is the Canonical SMILES of Acetamide, N-(2-(((aminocarbonyl)oxy)methyl)-1-methyl-1H-imidazol-5-yl)-?
The Canonical SMILES is CC(=O)NC1=CN=C(N1C)COC(=O)N.
What is the CAS number of Acetamide, N-(2-(((aminocarbonyl)oxy)methyl)-1-methyl-1H-imidazol-5-yl)-?
The CAS number is 91260-87-6.
What is the molecular weight of Acetamide, N-(2-(((aminocarbonyl)oxy)methyl)-1-methyl-1H-imidazol-5-yl)-?
The molecular weight is 212.21 g/mol.
How many hydrogen bond donor counts are there in Acetamide, N-(2-(((aminocarbonyl)oxy)methyl)-1-methyl-1H-imidazol-5-yl)-?
There are 2 hydrogen bond donor counts.
What is the topological polar surface area of Acetamide, N-(2-(((aminocarbonyl)oxy)methyl)-1-methyl-1H-imidazol-5-yl)-?
The topological polar surface area is 99.2.
Is Acetamide, N-(2-(((aminocarbonyl)oxy)methyl)-1-methyl-1H-imidazol-5-yl)- canonicalized?
Yes, the compound is canonicalized.