What is the molecular formula of 2,2-Dibromo-2,3-dihydro-1H-benz[f]inden-1-one?
The molecular formula is C13H8Br2O.
What is the molecular weight of 2,2-Dibromo-2,3-dihydro-1H-benz[f]inden-1-one?
The molecular weight is 340.01 g/mol.
When was 2,2-Dibromo-2,3-dihydro-1H-benz[f]inden-1-one created in PubChem?
It was created on February 16, 2015.
When was 2,2-Dibromo-2,3-dihydro-1H-benz[f]inden-1-one last modified in PubChem?
It was last modified on December 30, 2023.
What is the IUPAC name of 2,2-Dibromo-2,3-dihydro-1H-benz[f]inden-1-one?
The IUPAC name is 2,2-dibromo-1H-cyclopenta[b]naphthalen-3-one.
What is the InChI of 2,2-Dibromo-2,3-dihydro-1H-benz[f]inden-1-one?
The InChI is InChI=1S/C13H8Br2O/c14-13(15)7-10-5-8-3-1-2-4-9(8)6-11(10)12(13)16/h1-6H,7H2.
What is the InChIKey of 2,2-Dibromo-2,3-dihydro-1H-benz[f]inden-1-one?
The InChIKey is IHLGLVSDOIYDOZ-UHFFFAOYSA-N.
What is the canonical SMILES of 2,2-Dibromo-2,3-dihydro-1H-benz[f]inden-1-one?
The canonical SMILES is C1C2=CC3=CC=CC=C3C=C2C(=O)C1(Br)Br.
What is the XLogP3-AA value of 2,2-Dibromo-2,3-dihydro-1H-benz[f]inden-1-one?
The XLogP3-AA value is 4.5.
What is the topological polar surface area of 2,2-Dibromo-2,3-dihydro-1H-benz[f]inden-1-one?
The topological polar surface area is 17.1?^2.