CAS
909772-67-4 Purity
---
909772-67-4 Purity
---
Inquiry Basket
N-Cyclohexyl aspartic acid
CAS
90979-36-5
Catalog Number
ACM90979365
Category
Other Products
Molecular Weight
215.25
Molecular Formula
C10H17NO4
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
N-CYCLOHEXYL ASPARTIC ACID
What is the molecular formula of N-Cyclohexyl aspartic acid?
The molecular formula of N-Cyclohexyl aspartic acid is C10H17NO4.
What is the molecular weight of N-Cyclohexyl aspartic acid?
The molecular weight of N-Cyclohexyl aspartic acid is 215.25 g/mol.
What is the IUPAC name of N-Cyclohexyl aspartic acid?
The IUPAC name of N-Cyclohexyl aspartic acid is 2-(cyclohexylamino)butanedioic acid.
What is the Canonical SMILES representation of N-Cyclohexyl aspartic acid?
The Canonical SMILES representation of N-Cyclohexyl aspartic acid is C1CCC(CC1)NC(CC(=O)O)C(=O)O.
What is the InChIKey of N-Cyclohexyl aspartic acid?
The InChIKey of N-Cyclohexyl aspartic acid is ZFYIQPIHXRFFCZ-UHFFFAOYSA-N.
How many hydrogen bond donor counts does N-Cyclohexyl aspartic acid have?
N-Cyclohexyl aspartic acid has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does N-Cyclohexyl aspartic acid have?
N-Cyclohexyl aspartic acid has 5 hydrogen bond acceptor counts.
What is the exact mass of N-Cyclohexyl aspartic acid?
The exact mass of N-Cyclohexyl aspartic acid is 215.11575802 g/mol.
What is the topological polar surface area of N-Cyclohexyl aspartic acid?
The topological polar surface area of N-Cyclohexyl aspartic acid is 86.6 Ų.
Is N-Cyclohexyl aspartic acid a canonicalized compound?
Yes, N-Cyclohexyl aspartic acid is a canonicalized compound according to PubChem.
Recommended Products
![2,2-Dibromo-2,3-dihydro-1H-benz[f]inden-1-one](https://resource.alfa-chemistry.com/structure/909806-50-4.gif)
