90979-13-8 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of N-Cyclohexyl aspartic acid is C10H17NO4.
The molecular weight of N-Cyclohexyl aspartic acid is 215.25 g/mol.
The IUPAC name of N-Cyclohexyl aspartic acid is 2-(cyclohexylamino)butanedioic acid.
The Canonical SMILES representation of N-Cyclohexyl aspartic acid is C1CCC(CC1)NC(CC(=O)O)C(=O)O.
The InChIKey of N-Cyclohexyl aspartic acid is ZFYIQPIHXRFFCZ-UHFFFAOYSA-N.
N-Cyclohexyl aspartic acid has 3 hydrogen bond donor counts.
N-Cyclohexyl aspartic acid has 5 hydrogen bond acceptor counts.
The exact mass of N-Cyclohexyl aspartic acid is 215.11575802 g/mol.
The topological polar surface area of N-Cyclohexyl aspartic acid is 86.6 Ų.
Yes, N-Cyclohexyl aspartic acid is a canonicalized compound according to PubChem.
[Other Products] Fluorphlogopite(Mg3K[AlF2O(SiO3)3]) Catalog: ACM12003382 CAS: 12003-38-2 |