What is the molecular formula of 2-Methyl-5-phenyl-piperazine-1-carboxylic acid tert-butyl ester?
The molecular formula is C16H24N2O2.
When was 2-Methyl-5-phenyl-piperazine-1-carboxylic acid tert-butyl ester created?
It was created on October 2, 2007.
What is the molecular weight of 2-Methyl-5-phenyl-piperazine-1-carboxylic acid tert-butyl ester?
The molecular weight is 276.37 g/mol.
What is the IUPAC name of 2-Methyl-5-phenyl-piperazine-1-carboxylic acid tert-butyl ester?
The IUPAC name is tert-butyl 2-methyl-5-phenylpiperazine-1-carboxylate.
What is the InChI of 2-Methyl-5-phenyl-piperazine-1-carboxylic acid tert-butyl ester?
The InChI is InChI=1S/C16H24N2O2/c1-12-10-17-14(13-8-6-5-7-9-13)11-18(12)15(19)20-16(2,3)4/h5-9,12,14,17H,10-11H2,1-4H3.
What is the Canonical SMILES of 2-Methyl-5-phenyl-piperazine-1-carboxylic acid tert-butyl ester?
The Canonical SMILES is CC1CNC(CN1C(=O)OC(C)(C)C)C2=CC=CC=C2.
How many hydrogen bond donor counts are present in 2-Methyl-5-phenyl-piperazine-1-carboxylic acid tert-butyl ester?
There is 1 hydrogen bond donor count.
What is the topological polar surface area of 2-Methyl-5-phenyl-piperazine-1-carboxylic acid tert-butyl ester?
The topological polar surface area is 41.6 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
What is the complexity of 2-Methyl-5-phenyl-piperazine-1-carboxylic acid tert-butyl ester?
The complexity is 332.