What is the molecular formula of (1-Cyano-cyclohexyl)-carbamic acid tert-butyl ester?
The molecular formula is C12H20N2O2.
What is the molecular weight of (1-Cyano-cyclohexyl)-carbamic acid tert-butyl ester?
The molecular weight is 224.30 g/mol.
What are the synonyms for (1-Cyano-cyclohexyl)-carbamic acid tert-butyl ester?
Some synonyms include tert-butyl N-(1-cyanocyclohexyl)carbamate and tert-Butyl (1-cyanocyclohexyl)carbamate.
When was (1-Cyano-cyclohexyl)-carbamic acid tert-butyl ester created and modified?
It was created on 2007-10-02 and modified on 2023-12-30.
What is the IUPAC name of (1-Cyano-cyclohexyl)-carbamic acid tert-butyl ester?
The IUPAC name is tert-butyl N-(1-cyanocyclohexyl)carbamate.
What is the InChIKey of (1-Cyano-cyclohexyl)-carbamic acid tert-butyl ester?
The InChIKey is FHEWQQKIHCOSKJ-UHFFFAOYSA-N.
What is the Canonical SMILES of (1-Cyano-cyclohexyl)-carbamic acid tert-butyl ester?
The Canonical SMILES is CC(C)(C)OC(=O)NC1(CCCCC1)C#N.
What is the XLogP3-AA value for (1-Cyano-cyclohexyl)-carbamic acid tert-butyl ester?
The XLogP3-AA value is 2.3.
How many hydrogen bond donor counts does (1-Cyano-cyclohexyl)-carbamic acid tert-butyl ester have?
It has 1 hydrogen bond donor count.
Is (1-Cyano-cyclohexyl)-carbamic acid tert-butyl ester a canonicalized compound?
Yes, it is a canonicalized compound.