What is the IUPAC name of the compound with PubChem CID 16740826?
The IUPAC name of the compound is 2-(2-quinolin-6-yl-1H-indol-3-yl)ethanamine.
What is the molecular formula of the compound with PubChem CID 16740826?
The molecular formula is C19H17N3.
What is the molecular weight of the compound with PubChem CID 16740826?
The molecular weight is 287.4 g/mol.
What is the Canonical SMILES representation of the compound with PubChem CID 16740826?
The Canonical SMILES is C1=CC=C2C(=C1)C(=C(N2)C3=CC4=C(C=C3)N=CC=C4)CCN.
What is the InChIKey of the compound with PubChem CID 16740826?
The InChIKey is SUKKRFFHFNTDAU-UHFFFAOYSA-N.
How many hydrogen bond donor counts does the compound with PubChem CID 16740826 have?
The compound has 2 hydrogen bond donor counts.
What is the XLogP3-AA value for the compound with PubChem CID 16740826?
The XLogP3-AA value is 3.3.
What is the exact mass of the compound with PubChem CID 16740826?
The exact mass is 287.142247555 g/mol.
Does the compound with PubChem CID 16740826 have any defined atom stereocenter count?
No, the compound has 0 defined atom stereocenter count.
Is the compound with PubChem CID 16740826 canonicalized?
Yes, the compound is canonicalized.