CAS
904815-76-5 Purity
---
904815-76-5 Purity
---
Inquiry Basket
6-(Hexahydro-1H-azepin-2-yl)quinoline
CAS
904816-03-1
Catalog Number
ACM904816031
Category
Other Products
Molecular Formula
C15H18N2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound with PubChem CID 16740811?
The IUPAC name of the compound is 6-(azepan-2-yl)quinoline.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C15H18N2/c1-2-6-14(16-9-3-1)13-7-8-15-12(11-13)5-4-10-17-15/h4-5,7-8,10-11,14,16H,1-3,6,9H2.
What is the InChIKey of the compound?
The InChIKey of the compound is VUWMEMWWPBIMMA-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is C1CCC(NCC1)C2=CC3=C(C=C2)N=CC=C3.
What is the molecular weight of the compound?
The molecular weight of the compound is 226.32 g/mol.
How many hydrogen bond donor counts are there in the compound?
There is 1 hydrogen bond donor count in the compound.
How many hydrogen bond acceptor counts are there in the compound?
There are 2 hydrogen bond acceptor counts in the compound.
What is the exact mass of the compound?
The exact mass of the compound is 226.146998583 g/mol.
Is the compound canonicalized?
Yes, the compound is canonicalized.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 24.9 Ų.
Recommended Products
![2-(3-Methoxy-phenyl)-2,3,4,5-tetrahydro-1H-benzo[b][1,4]diazepine](https://resource.alfa-chemistry.com/structure/904815-76-5.gif)
![2-(4-Methoxy-phenyl)-2,3,4,5-tetrahydro-1H-benzo[b][1,4]diazepine](https://resource.alfa-chemistry.com/structure/904815-83-4.gif)
CAS
904815-83-4 Purity
---
904815-83-4 Purity
---
CAS
904815-90-3 Purity
---
904815-90-3 Purity
---
CAS
904816-06-4 Purity
---
904816-06-4 Purity
---
CAS
904816-11-1 Purity
---
904816-11-1 Purity
---
