What is the molecular formula of 3-Bromo-2-tert-butyl-6-chloro-imidazo[1,2-a]pyridine?
The molecular formula is C11H12BrClN2.
When was 3-Bromo-2-tert-butyl-6-chloro-imidazo[1,2-a]pyridine created?
It was created on October 2, 2007.
What is the IUPAC name of 3-Bromo-2-tert-butyl-6-chloro-imidazo[1,2-a]pyridine?
The IUPAC name is 3-bromo-2-tert-butyl-6-chloroimidazo[1,2-a]pyridine.
What is the Canonical SMILES notation of 3-Bromo-2-tert-butyl-6-chloro-imidazo[1,2-a]pyridine?
The Canonical SMILES is CC(C)(C)C1=C(N2C=C(C=CC2=N1)Cl)Br.
What is the computed XLogP3-AA value of 3-Bromo-2-tert-butyl-6-chloro-imidazo[1,2-a]pyridine?
The XLogP3-AA value is 5.1.
How many hydrogen bond donor counts does 3-Bromo-2-tert-butyl-6-chloro-imidazo[1,2-a]pyridine have?
It has 0 hydrogen bond donor counts.
What is the Exact Mass of 3-Bromo-2-tert-butyl-6-chloro-imidazo[1,2-a]pyridine?
The Exact Mass is 285.98724 g/mol.
How many defined atom stereocenter counts does 3-Bromo-2-tert-butyl-6-chloro-imidazo[1,2-a]pyridine have?
It has 0 defined atom stereocenter counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
What is the topological polar surface area of 3-Bromo-2-tert-butyl-6-chloro-imidazo[1,2-a]pyridine?
The topological polar surface area is 17.3 Å2.