90322-88-6 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C9H7N3O3.
The molecular weight of the compound is 205.17 g/mol.
The IUPAC name of the compound is 7-amino-2-oxo-1H-1,8-naphthyridine-4-carboxylic acid.
The CAS number of the compound is 90323-16-3.
The InChI of the compound is InChI=1S/C9H7N3O3/c10-6-2-1-4-5(9(14)15)3-7(13)12-8(4)11-6/h1-3H,(H,14,15)(H3,10,11,12,13).
The InChIKey of the compound is BXHBQLMTFKNEOC-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=NC2=C1C(=CC(=O)N2)C(=O)O)N.
The XLogP3-AA value of the compound is -0.5.
The compound has 3 hydrogen bond donor counts.
The compound has 5 hydrogen bond acceptor counts.