90322-83-1 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C9H7N3O2.
The molecular weight of the compound is 189.17 g/mol.
The IUPAC name of the compound is 4-(triazol-2-yl)benzoic acid.
The InChI of the compound is InChI=1S/C9H7N3O2/c13-9(14)7-1-3-8(4-2-7)12-10-5-6-11-12/h1-6H,(H,13,14).
The InChIKey of the compound is KRRWMVZQMVHANB-UHFFFAOYSA-N.
The Canonical SMILES of the compound is C1=CC(=CC=C1C(=O)O)N2N=CC=N2.
The compound has 1 hydrogen bond donor count.
The compound has 4 hydrogen bond acceptor counts.
The topological polar surface area of the compound is 68 Å^2.
Yes, the compound is canonicalized.