What is the molecular formula of N-(3-Methylbenzyl)piperidine-4-carboxylic acid?
The molecular formula is C14H19NO2.
When was N-(3-Methylbenzyl)piperidine-4-carboxylic acid first created?
It was first created on September 12, 2005.
What is the synonyms for N-(3-Methylbenzyl)piperidine-4-carboxylic acid?
Synonyms include 1-(3-methylbenzyl)piperidine-4-carboxylic acid, 901920-98-7, and N-(3-Methylbenzyl)piperidine-4-carboxylic acid.
What is the molecular weight of N-(3-Methylbenzyl)piperidine-4-carboxylic acid?
The molecular weight is 233.31 g/mol.
What is the IUPAC Name for N-(3-Methylbenzyl)piperidine-4-carboxylic acid?
The IUPAC Name is 1-[(3-methylphenyl)methyl]piperidine-4-carboxylic acid.
What is the InChIKey for N-(3-Methylbenzyl)piperidine-4-carboxylic acid?
The InChIKey is QRDJOEBTRLYMKT-UHFFFAOYSA-N.
What is the Canonical SMILES for N-(3-Methylbenzyl)piperidine-4-carboxylic acid?
The Canonical SMILES is CC1=CC(=CC=C1)CN2CCC(CC2)C(=O)O.
How many hydrogen bond donor counts does N-(3-Methylbenzyl)piperidine-4-carboxylic acid have?
It has 1 hydrogen bond donor count.
What is the XLogP3-AA value for N-(3-Methylbenzyl)piperidine-4-carboxylic acid?
The XLogP3-AA value is -0.1.
Is N-(3-Methylbenzyl)piperidine-4-carboxylic acid considered as canonicalized compound?
Yes, the compound is canonicalized according to PubChem.