CAS
901920-33-0 Purity
96%
901920-33-0 Purity
96%
Shopping basket
1-(3-Chloro-benzyl)-piperidine-4-carboxylic acid hydrochloride
CAS
901920-70-5
Catalog Number
ACM901920705
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C13H16ClNO2.
What is the molecular weight of the compound?
The molecular weight of the compound is 253.72 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 1-[(3-chlorophenyl)methyl]piperidine-4-carboxylic acid.
What is the InChIKey of the compound?
The InChIKey of the compound is PUGKULNOZQXTSX-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1CN(CCC1C(=O)O)CC2=CC(=CC=C2)Cl.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 0.1.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 40.5 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Please kindly note that our products are for research use only.
Recommended Products
CAS
901920-52-3 Purity
---
901920-52-3 Purity
---
CAS
901923-63-5 Purity
---
901923-63-5 Purity
---
