CAS
9015-81-0 Purity
---
9015-81-0 Purity
---
Inquiry Basket
Butyl[(1-methylpyrrolidin-2-yl)methyl]amine
CAS
901585-77-1
Catalog Number
ACM901585771
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of butyl[(1-methylpyrrolidin-2-yl)methyl]amine?
The molecular formula of butyl[(1-methylpyrrolidin-2-yl)methyl]amine is C10H22N2.
What is the molecular weight of butyl[(1-methylpyrrolidin-2-yl)methyl]amine?
The molecular weight of butyl[(1-methylpyrrolidin-2-yl)methyl]amine is 170.30 g/mol.
What is the IUPAC name of butyl[(1-methylpyrrolidin-2-yl)methyl]amine?
The IUPAC name of butyl[(1-methylpyrrolidin-2-yl)methyl]amine is N-[(1-methylpyrrolidin-2-yl)methyl]butan-1-amine.
What is the InChI of butyl[(1-methylpyrrolidin-2-yl)methyl]amine?
The InChI of butyl[(1-methylpyrrolidin-2-yl)methyl]amine is InChI=1S/C10H22N2/c1-3-4-7-11-9-10-6-5-8-12(10)2/h10-11H,3-9H2,1-2H3.
What is the InChIKey of butyl[(1-methylpyrrolidin-2-yl)methyl]amine?
The InChIKey of butyl[(1-methylpyrrolidin-2-yl)methyl]amine is UEIINEGMKGTLMM-UHFFFAOYSA-N.
How many hydrogen bond donor counts does butyl[(1-methylpyrrolidin-2-yl)methyl]amine have?
Butyl[(1-methylpyrrolidin-2-yl)methyl]amine has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does butyl[(1-methylpyrrolidin-2-yl)methyl]amine have?
Butyl[(1-methylpyrrolidin-2-yl)methyl]amine has 2 hydrogen bond acceptor counts.
What is the exact mass of butyl[(1-methylpyrrolidin-2-yl)methyl]amine?
The exact mass of butyl[(1-methylpyrrolidin-2-yl)methyl]amine is 170.178298710 g/mol.
How many rotatable bond counts does butyl[(1-methylpyrrolidin-2-yl)methyl]amine have?
Butyl[(1-methylpyrrolidin-2-yl)methyl]amine has 5 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![N-[(1-Ethyl-2-pyrrolidinyl)methyl]-1-propanamine](https://resource.alfa-chemistry.com/structure/901585-69-1.gif)
![N-[(1-Butyl-2-pyrrolidinyl)methyl]-1-propanamine](https://resource.alfa-chemistry.com/structure/901585-73-7.gif)
![N-[(1-Butyl-2-piperidinyl)methyl]-1-propanamine](https://resource.alfa-chemistry.com/structure/901586-09-2.gif)
![Butyl[(1-methylpiperidin-2-yl)methyl]amine](https://resource.alfa-chemistry.com/structure/901586-13-8.gif)
![Butyl[(1-propylpiperidin-2-yl)methyl]amine](https://resource.alfa-chemistry.com/structure/901586-17-2.gif)
