What is the molecular formula of 11-Hydroxy-5H-5,7a,12-triaza-benzo[a]anthracene-6,7-dione?
The molecular formula is C15H9N3O3.
When was 11-Hydroxy-5H-5,7a,12-triaza-benzo[a]anthracene-6,7-dione created in PubChem?
It was created on December 11, 2015.
What is the molecular weight of 11-Hydroxy-5H-5,7a,12-triaza-benzo[a]anthracene-6,7-dione?
The molecular weight is 279.25 g/mol.
What is the IUPAC name of 11-Hydroxy-5H-5,7a,12-triaza-benzo[a]anthracene-6,7-dione?
The IUPAC name is 16-hydroxy-8,12,18-triazatetracyclo[8.8.0.0 2,7 .0 12,17 ]octadeca-1(10),2,4,6,13,15,17-heptaene-9,11-dione.
What is the InChI code of 11-Hydroxy-5H-5,7a,12-triaza-benzo[a]anthracene-6,7-dione?
The InChI code is InChI=1S/C15H9N3O3/c19-10-6-3-7-18-13(10)17-12-8-4-1-2-5-9(8)16-14(20)11(12)15(18)21/h1-7,19H,(H,16,20).
How many hydrogen bond donor counts does 11-Hydroxy-5H-5,7a,12-triaza-benzo[a]anthracene-6,7-dione have?
It has 2 hydrogen bond donor counts.
What is the XLogP3-AA value of 11-Hydroxy-5H-5,7a,12-triaza-benzo[a]anthracene-6,7-dione?
The XLogP3-AA value is 0.7.
How many hydrogen bond acceptor counts does 11-Hydroxy-5H-5,7a,12-triaza-benzo[a]anthracene-6,7-dione have?
It has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of 11-Hydroxy-5H-5,7a,12-triaza-benzo[a]anthracene-6,7-dione?
The topological polar surface area is 82.2.
Is 11-Hydroxy-5H-5,7a,12-triaza-benzo[a]anthracene-6,7-dione considered as a canonicalized compound?
Yes, it is considered as a canonicalized compound.