What is the molecular formula of Methyl 1,2,5,6-tetrahydro-1-methylnicotinate, mono[(3-acetamido-4-hydroxyphenyl)arsonate]?
The molecular formula is C16H23AsN2O7.
When was Methyl 1,2,5,6-tetrahydro-1-methylnicotinate, mono[(3-acetamido-4-hydroxyphenyl)arsonate] created and modified?
It was created on 2005-08-08 and last modified on 2023-12-30.
What is the IUPAC name of Methyl 1,2,5,6-tetrahydro-1-methylnicotinate, mono[(3-acetamido-4-hydroxyphenyl)arsonate]?
The IUPAC name is (3-acetamido-4-hydroxyphenyl)arsonic acid; methyl 1-methyl-3,6-dihydro-2H-pyridine-5-carboxylate.
What is the molecular weight of Methyl 1,2,5,6-tetrahydro-1-methylnicotinate, mono[(3-acetamido-4-hydroxyphenyl)arsonate]?
The molecular weight is 430.28 g/mol.
What is the Canonical SMILES of Methyl 1,2,5,6-tetrahydro-1-methylnicotinate, mono[(3-acetamido-4-hydroxyphenyl)arsonate]?
The Canonical SMILES is CC(=O)NC1=C(C=CC(=C1)[As](=O)(O)O)O.CN1CCC=C(C1)C(=O)OC.
What is the CAS number of Methyl 1,2,5,6-tetrahydro-1-methylnicotinate, mono[(3-acetamido-4-hydroxyphenyl)arsonate]?
The CAS number is 900-77-6.
What are the hydrogen bond donor count and acceptor count of Methyl 1,2,5,6-tetrahydro-1-methylnicotinate, mono[(3-acetamido-4-hydroxyphenyl)arsonate]?
The hydrogen bond donor count is 4, and the acceptor count is 8.
What is the topological polar surface area of Methyl 1,2,5,6-tetrahydro-1-methylnicotinate, mono[(3-acetamido-4-hydroxyphenyl)arsonate]?
The topological polar surface area is 136 Ų.
How many covalently-bonded units are there in Methyl 1,2,5,6-tetrahydro-1-methylnicotinate, mono[(3-acetamido-4-hydroxyphenyl)arsonate]?
There are 2 covalently-bonded units.
Is the compound canonicalized?
Yes, the compound is canonicalized.