CAS
899808-67-4 Purity
96%
899808-67-4 Purity
96%
Inquiry Basket
5-Amino-2-(3-carboxypropanoylamino)pentanoic acid
CAS
899816-95-6
Catalog Number
ACM899816956
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound with PubChem CID 920?
The molecular formula is C9H16N2O5.
What is the molecular weight of the compound?
The molecular weight is 232.23 g/mol.
When was the compound created in PubChem?
The compound was created on June 23, 2005.
What is the IUPAC name of the compound?
The IUPAC name is 5-amino-2-(3-carboxypropanoylamino)pentanoic acid.
What is the Canonical SMILES representation of the compound?
The Canonical SMILES is C(CC(C(=O)O)NC(=O)CCC(=O)O)CN.
How many hydrogen bond donor counts does the compound have?
The compound has 4 hydrogen bond donor counts.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value is -3.9.
How many rotatable bond counts does the compound have?
The compound has 8 rotatable bond counts.
What is the topological polar surface area of the compound?
The topological polar surface area is 130 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
CAS
899822-99-2 Purity
---
899822-99-2 Purity
---
