What is the molecular formula of Ethyl 2-amino-4-(3-chloro)phenyl thiazole-5-carboxylate?
The molecular formula is C12H11ClN2O2S.
When was Ethyl 2-amino-4-(3-chloro)phenyl thiazole-5-carboxylate created and last modified in PubChem?
It was created on 2009-05-28 and last modified on 2023-12-30.
What is the IUPAC name of Ethyl 2-amino-4-(3-chloro)phenyl thiazole-5-carboxylate?
The IUPAC name is ethyl 2-amino-4-(3-chlorophenyl)-1,3-thiazole-5-carboxylate.
What is the InChIKey of Ethyl 2-amino-4-(3-chloro)phenyl thiazole-5-carboxylate?
The InChIKey is SPZCHSYCFKKIBY-UHFFFAOYSA-N.
What is the Canonical SMILES representation of Ethyl 2-amino-4-(3-chloro)phenyl thiazole-5-carboxylate?
The Canonical SMILES representation is CCOC(=O)C1=C(N=C(S1)N)C2=CC(=CC=C2)Cl.
What is the molecular weight of Ethyl 2-amino-4-(3-chloro)phenyl thiazole-5-carboxylate?
The molecular weight is 282.75 g/mol.
How many hydrogen bond donor counts does Ethyl 2-amino-4-(3-chloro)phenyl thiazole-5-carboxylate have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of Ethyl 2-amino-4-(3-chloro)phenyl thiazole-5-carboxylate?
The topological polar surface area is 93.4 Å^2.
Does Ethyl 2-amino-4-(3-chloro)phenyl thiazole-5-carboxylate have any defined atom stereocenter count?
No, it has 0 defined atom stereocenter count.
Is Ethyl 2-amino-4-(3-chloro)phenyl thiazole-5-carboxylate a canonicalized compound in PubChem?
Yes, it is a canonicalized compound in PubChem.