What is the molecular formula of 2-Amino-4-(3,4-dichlorophenyl)-5-thiazolecarboxylic acid ethyl ester?
The molecular formula is C12H10Cl2N2O2S.
What is the molecular weight of 2-Amino-4-(3,4-dichlorophenyl)-5-thiazolecarboxylic acid ethyl ester?
The molecular weight is 317.2 g/mol.
When was 2-Amino-4-(3,4-dichlorophenyl)-5-thiazolecarboxylic acid ethyl ester created?
It was created on February 16, 2015.
When was 2-Amino-4-(3,4-dichlorophenyl)-5-thiazolecarboxylic acid ethyl ester last modified?
It was last modified on December 30, 2023.
What is the IUPAC name of 2-Amino-4-(3,4-dichlorophenyl)-5-thiazolecarboxylic acid ethyl ester?
The IUPAC name is ethyl 2-amino-4-(3,4-dichlorophenyl)-1,3-thiazole-5-carboxylate.
What is the InChI of 2-Amino-4-(3,4-dichlorophenyl)-5-thiazolecarboxylic acid ethyl ester?
The InChI is InChI=1S/C12H10Cl2N2O2S/c1-2-18-11(17)10-9(16-12(15)19-10)6-3-4-7(13)8(14)5-6/h3-5H,2H2,1H3,(H2,15,16).
What is the InChIKey of 2-Amino-4-(3,4-dichlorophenyl)-5-thiazolecarboxylic acid ethyl ester?
The InChIKey is JXPXUOAMHKRYER-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-4-(3,4-dichlorophenyl)-5-thiazolecarboxylic acid ethyl ester?
The canonical SMILES is CCOC(=O)C1=C(N=C(S1)N)C2=CC(=C(C=C2)Cl)Cl.
What is the XLogP3-AA value of 2-Amino-4-(3,4-dichlorophenyl)-5-thiazolecarboxylic acid ethyl ester?
The XLogP3-AA value is 4.1.
What is the hydrogen bond donor count of 2-Amino-4-(3,4-dichlorophenyl)-5-thiazolecarboxylic acid ethyl ester?
The hydrogen bond donor count is 1.