What is the molecular formula of cis-Decahydro-2a,4a,6a,8a-tetraazacyclopent[fg]acenaphthylene?
The molecular formula is C10H18N4.
What is the molecular weight of cis-Decahydro-2a,4a,6a,8a-tetraazacyclopent[fg]acenaphthylene?
The molecular weight is 194.28 g/mol.
What is the IUPAC name of cis-Decahydro-2a,4a,6a,8a-tetraazacyclopent[fg]acenaphthylene?
The IUPAC name is 1,4,7,10-tetrazatetracyclo[5.5.2.0 4,13 .0 10,14 ]tetradecane.
What is the InChI of cis-Decahydro-2a,4a,6a,8a-tetraazacyclopent[fg]acenaphthylene?
The InChI is InChI=1S/C10H18N4/c1-2-12-7-8-14-4-3-13-6-5-11(1)9(12)10(13)14/h9-10H,1-8H2.
What is the InChIKey of cis-Decahydro-2a,4a,6a,8a-tetraazacyclopent[fg]acenaphthylene?
The InChIKey is YSPZOYMEWUTYDA-UHFFFAOYSA-N.
What is the canonical SMILES of cis-Decahydro-2a,4a,6a,8a-tetraazacyclopent[fg]acenaphthylene?
The canonical SMILES is C1CN2CCN3CCN4C3C2N1CC4.
What is the XLogP3-AA value of cis-Decahydro-2a,4a,6a,8a-tetraazacyclopent[fg]acenaphthylene?
The XLogP3-AA value is -0.2.
How many hydrogen bond donor counts are there in cis-Decahydro-2a,4a,6a,8a-tetraazacyclopent[fg]acenaphthylene?
There are 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in cis-Decahydro-2a,4a,6a,8a-tetraazacyclopent[fg]acenaphthylene?
There are 4 hydrogen bond acceptor counts.
How many rotatable bond counts are there in cis-Decahydro-2a,4a,6a,8a-tetraazacyclopent[fg]acenaphthylene?
There are 0 rotatable bond counts.