CAS
214078-93-0 Purity
---
214078-93-0 Purity
---
Inquiry Basket
2-(3-Chlorophenoxy)-N-hydroxyethanimidamide
CAS
261959-19-7
Catalog Number
ACM261959197
Category
Other Products
Molecular Weight
200.63
Molecular Formula
C8H9ClN2O2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C8H9ClN2O2.
What is the molecular weight of the compound?
The molecular weight of the compound is 200.62 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-(3-chlorophenoxy)-N'-hydroxyethanimidamide.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H9ClN2O2/c9-6-2-1-3-7(4-6)13-5-8(10)11-12/h1-4,12H,5H2,(H2,10,11).
What is the InChIKey of the compound?
The InChIKey of the compound is UFJNDLYGDWVOFJ-UHFFFAOYSA-N.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is C1=CC(=CC(=C1)Cl)OCC(=NO)N.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 3 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![cis-Decahydro-2a,4a,6a,8a-tetraazacyclopent[fg]acenaphthylene](https://resource.alfa-chemistry.com/structure/79236-92-3.gif)
CAS
79236-92-3 Purity
---
79236-92-3 Purity
---
