What is the molecular formula of [2,3,3,3-Tetrafluoro-2-(trifluoromethyl)propyl]oxirane?
The molecular formula is C6H5F7O.
What is the molecular weight of [2,3,3,3-Tetrafluoro-2-(trifluoromethyl)propyl]oxirane?
The molecular weight is 226.09 g/mol.
What is the IUPAC name of [2,3,3,3-Tetrafluoro-2-(trifluoromethyl)propyl]oxirane?
The IUPAC name is 2-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]oxirane.
What is the InChI of [2,3,3,3-Tetrafluoro-2-(trifluoromethyl)propyl]oxirane?
The InChI is InChI=1S/C6H5F7O/c7-4(5(8,9)10,6(11,12)13)1-3-2-14-3/h3H,1-2H2.
What is the InChIKey of [2,3,3,3-Tetrafluoro-2-(trifluoromethyl)propyl]oxirane?
The InChIKey is ZCSHSWXXDMBWOP-UHFFFAOYSA-N.
What is the canonical SMILES of [2,3,3,3-Tetrafluoro-2-(trifluoromethyl)propyl]oxirane?
The canonical SMILES is C1C(O1)CC(C(F)(F)F)(C(F)(F)F)F.
What is the CAS number of [2,3,3,3-Tetrafluoro-2-(trifluoromethyl)propyl]oxirane?
The CAS number is 74328-57-7.
What is the European Community (EC) number of [2,3,3,3-Tetrafluoro-2-(trifluoromethyl)propyl]oxirane?
The EC number is 623-025-4.
What is the DSSTox Substance ID of [2,3,3,3-Tetrafluoro-2-(trifluoromethyl)propyl]oxirane?
The DSSTox Substance ID is DTXSID80881238.
What is the XLogP3-AA value of [2,3,3,3-Tetrafluoro-2-(trifluoromethyl)propyl]oxirane?
The XLogP3-AA value is 2.7.