What is the molecular formula of Potassium (3-nitrophenyl)trifluoroborate?
The molecular formula is C6H4BF3KNO2.
What is the molecular weight of Potassium (3-nitrophenyl)trifluoroborate?
The molecular weight is 229.01 g/mol.
What is the IUPAC name of Potassium (3-nitrophenyl)trifluoroborate?
The IUPAC name is potassium;trifluoro-(3-nitrophenyl)boranuide.
What is the InChI of Potassium (3-nitrophenyl)trifluoroborate?
The InChI is InChI=1S/C6H4BF3NO2.K/c8-7(9,10)5-2-1-3-6(4-5)11(12)13;/h1-4H;/q-1;+1.
What is the InChIKey of Potassium (3-nitrophenyl)trifluoroborate?
The InChIKey is ZKZMSCLFLMORNI-UHFFFAOYSA-N.
What is the canonical SMILES of Potassium (3-nitrophenyl)trifluoroborate?
The canonical SMILES is [B-](C1=CC(=CC=C1)[N+](=O)[O-])(F)(F)F.[K+].
What is the CAS number of Potassium (3-nitrophenyl)trifluoroborate?
The CAS number is 192863-40-4.
What is the European Community (EC) number of Potassium (3-nitrophenyl)trifluoroborate?
The EC number is 623-908-4.
What is the hydrogen bond donor count of Potassium (3-nitrophenyl)trifluoroborate?
The hydrogen bond donor count is 0.
What is the hydrogen bond acceptor count of Potassium (3-nitrophenyl)trifluoroborate?
The hydrogen bond acceptor count is 6.