2,4-Dichlorobenzenediazonium tetrafluoroborate

• CAS: 21872-70-8
• Catalog Number: ACM21872708
• Category: Borate

Custom Q&A

What is the molecular weight of 2,4-dichlorobenzenediazonium tetrafluoroborate?

The molecular weight of 2,4-dichlorobenzenediazonium tetrafluoroborate is 260.81 g/mol.

What is the IUPAC name of 2,4-dichlorobenzenediazonium tetrafluoroborate?

The IUPAC name of 2,4-dichlorobenzenediazonium tetrafluoroborate is [B-](F)(F)(F)F.C1=CC(=C(C=C1Cl)Cl)[N+]#N.

What is the InChI of 2,4-dichlorobenzenediazonium tetrafluoroborate?

The InChI of 2,4-dichlorobenzenediazonium tetrafluoroborate is InChI=1S/C6H3Cl2N2.BF4/c7-4-1-2-6(10-9)5(8)3-4;2-1(3,4)5/h1-3H;/q+1;-1.

What is the InChIKey of 2,4-dichlorobenzenediazonium tetrafluoroborate?

The InChIKey of 2,4-dichlorobenzenediazonium tetrafluoroborate is WZSTVAYXFYACGJ-UHFFFAOYSA-N.

What is the canonical SMILES of 2,4-dichlorobenzenediazonium tetrafluoroborate?

The canonical SMILES of 2,4-dichlorobenzenediazonium tetrafluoroborate is [B-](F)(F)(F)F.C1=CC(=C(C=C1Cl)Cl)[N+]#N.

What is the molecular formula of 2,4-dichlorobenzenediazonium tetrafluoroborate?

The molecular formula of 2,4-dichlorobenzenediazonium tetrafluoroborate is C6H3BCl2F4N2.

What is the CAS number of 2,4-dichlorobenzenediazonium tetrafluoroborate?

The CAS number of 2,4-dichlorobenzenediazonium tetrafluoroborate is 21872-70-8.

How many hydrogen bond donor count does 2,4-dichlorobenzenediazonium tetrafluoroborate have?

2,4-dichlorobenzenediazonium tetrafluoroborate has 0 hydrogen bond donor count.

How many hydrogen bond acceptor count does 2,4-dichlorobenzenediazonium tetrafluoroborate have?

2,4-dichlorobenzenediazonium tetrafluoroborate has 6 hydrogen bond acceptor count.

How many rotatable bond count does 2,4-dichlorobenzenediazonium tetrafluoroborate have?

2,4-dichlorobenzenediazonium tetrafluoroborate has 0 rotatable bond count.