Boc-2-aminopyridine-3-boronic acid pinacol ester

• CAS: 1072944-99-0
• Catalog Number: ACM1072944990
• Category: Boronic Esters

Custom Q&A

What is the molecular formula of Boc-2-aminopyridine-3-boronic acid pinacol ester?

The molecular formula is C16H27BN2O5.

What are the synonyms of Boc-2-aminopyridine-3-boronic acid pinacol ester?

The synonyms are BCP23336, XSB94499, AKOS015891544, tert-Butyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-ylcarbamate.

What is the molecular weight of Boc-2-aminopyridine-3-boronic acid pinacol ester?

The molecular weight is 338.2 g/mol.

What is the IUPAC Name of Boc-2-aminopyridine-3-boronic acid pinacol ester?

The IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[2-[(2-methylpropan-2-yl)oxycarbonylamino]pyridin-3-yl]borinic acid.

What is the InChI of Boc-2-aminopyridine-3-boronic acid pinacol ester?

The InChI is InChI=1S/C16H27BN2O5/c1-14(2,3)23-13(20)19-12-11(9-8-10-18-12)17(22)24-16(6,7)15(4,5)21/h8-10,21-22H,1-7H3,(H,18,19,20).

What is the InChIKey of Boc-2-aminopyridine-3-boronic acid pinacol ester?

The InChIKey is UGHSVJXIYKOZSL-UHFFFAOYSA-N.

What is the Canonical SMILES of Boc-2-aminopyridine-3-boronic acid pinacol ester?

The Canonical SMILES is B(C1=C(N=CC=C1)NC(=O)OC(C)(C)C)(O)OC(C)(C)C(C)(C)O.

What is the hydrogen bond donor count of Boc-2-aminopyridine-3-boronic acid pinacol ester?

The hydrogen bond donor count is 3.

What is the hydrogen bond acceptor count of Boc-2-aminopyridine-3-boronic acid pinacol ester?

The hydrogen bond acceptor count is 6.

Is Boc-2-aminopyridine-3-boronic acid pinacol ester a canonicalized compound?

Yes, Boc-2-aminopyridine-3-boronic acid pinacol ester is a canonicalized compound.