1,3-Phenyldiboronic acid, bis(pinacol) ester

CAS

196212-27-8

Catalog Number

ACM196212278-1

Category

Boronic Esters

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

What is the molecular formula of 1,3-Phenyldiboronic acid, bis(pinacol) ester?

The molecular formula of 1,3-Phenyldiboronic acid, bis(pinacol) ester is C18H28B2O4.

What is the molecular weight of 1,3-Phenyldiboronic acid, bis(pinacol) ester?

The molecular weight of 1,3-Phenyldiboronic acid, bis(pinacol) ester is 330.0 g/mol.

What is the IUPAC name of 1,3-Phenyldiboronic acid, bis(pinacol) ester?

The IUPAC name of 1,3-Phenyldiboronic acid, bis(pinacol) ester is 4,4,5,5-tetramethyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,2-dioxaborolane.

What is the InChI of 1,3-Phenyldiboronic acid, bis(pinacol) ester?

The InChI of 1,3-Phenyldiboronic acid, bis(pinacol) ester is InChI=1S/C18H28B2O4/c1-15(2)16(3,4)22-19(21-15)13-10-9-11-14(12-13)20-23-17(5,6)18(7,8)24-20/h9-12H,1-8H3.

What is the InChIKey of 1,3-Phenyldiboronic acid, bis(pinacol) ester?

The InChIKey of 1,3-Phenyldiboronic acid, bis(pinacol) ester is LLQQCDJVSYEQQQ-UHFFFAOYSA-N.

What is the canonical SMILES of 1,3-Phenyldiboronic acid, bis(pinacol) ester?

The canonical SMILES of 1,3-Phenyldiboronic acid, bis(pinacol) ester is B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)B3OC(C(O3)(C)C)(C)C.

What is the CAS number of 1,3-Phenyldiboronic acid, bis(pinacol) ester?

The CAS number of 1,3-Phenyldiboronic acid, bis(pinacol) ester is 196212-27-8.

What is the EC number of 1,3-Phenyldiboronic acid, bis(pinacol) ester?

The EC number of 1,3-Phenyldiboronic acid, bis(pinacol) ester is 691-533-3.

What is the DSSTox Substance ID of 1,3-Phenyldiboronic acid, bis(pinacol) ester?

The DSSTox Substance ID of 1,3-Phenyldiboronic acid, bis(pinacol) ester is DTXSID30656453.

Is 1,3-Phenyldiboronic acid, bis(pinacol) ester a canonicalized compound?

Yes, 1,3-Phenyldiboronic acid, bis(pinacol) ester is a canonicalized compound according to PubChem.