(Benzo[1,2,5]thiadiazol-4-yloxy)-acetic acid

• Catalog Number: ACMA00002791
• Category: Ethers
• Molecular Weight: 210.21
• Molecular Formula: C₈H₆ClFO₂
• Hazard Statements: H302-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (Benzo[1,2,5]thiadiazol-4-yloxy)-acetic acid?

The molecular formula is C8H6N2O3S.

What is the molecular weight of (Benzo[1,2,5]thiadiazol-4-yloxy)-acetic acid?

The molecular weight is 210.21 g/mol.

What is the IUPAC name of (Benzo[1,2,5]thiadiazol-4-yloxy)-acetic acid?

The IUPAC name is 2-(2,1,3-benzothiadiazol-4-yloxy)acetic acid.

What is the InChI of (Benzo[1,2,5]thiadiazol-4-yloxy)-acetic acid?

The InChI is InChI=1S/C8H6N2O3S/c11-7(12)4-13-6-3-1-2-5-8(6)10-14-9-5/h1-3H,4H2,(H,11,12).

What is the InChIKey of (Benzo[1,2,5]thiadiazol-4-yloxy)-acetic acid?

The InChIKey is ZIGWXPPBJHAPGN-UHFFFAOYSA-N.

What is the canonical SMILES of (Benzo[1,2,5]thiadiazol-4-yloxy)-acetic acid?

The canonical SMILES is C1=CC2=NSN=C2C(=C1)OCC(=O)O.

What is the ChEMBL ID of (Benzo[1,2,5]thiadiazol-4-yloxy)-acetic acid?

The ChEMBL ID is CHEMBL1585123.

What is the XLogP3-AA value of (Benzo[1,2,5]thiadiazol-4-yloxy)-acetic acid?

The XLogP3-AA value is 1.4.

How many hydrogen bond donor counts does (Benzo[1,2,5]thiadiazol-4-yloxy)-acetic acid have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does (Benzo[1,2,5]thiadiazol-4-yloxy)-acetic acid have?

It has 6 hydrogen bond acceptor counts.