What is the molecular formula of (Phenylcyclopropyl)methylamine hydrochloride?
The molecular formula is C10H14ClN.
What is the molecular weight of (Phenylcyclopropyl)methylamine hydrochloride?
The molecular weight is 183.68 g/mol.
What is the IUPAC Name of (Phenylcyclopropyl)methylamine hydrochloride?
The IUPAC Name is (1-phenylcyclopropyl)methanamine; hydrochloride.
What is the InChI of (Phenylcyclopropyl)methylamine hydrochloride?
The InChI is InChI=1S/C10H13N.ClH/c11-8-10(6-7-10)9-4-2-1-3-5-9;/h1-5H,6-8,11H2;1H.
What is the InChIKey of (Phenylcyclopropyl)methylamine hydrochloride?
The InChIKey is SFMJEPXECDDEHC-UHFFFAOYSA-N.
What is the Canonical SMILES of (Phenylcyclopropyl)methylamine hydrochloride?
The Canonical SMILES is C1CC1(CN)C2=CC=CC=C2.Cl.
What is the CAS number of (Phenylcyclopropyl)methylamine hydrochloride?
The CAS number is 935-43-3.
What is the hydrogen bond donor count of (Phenylcyclopropyl)methylamine hydrochloride?
The hydrogen bond donor count is 2.
What is the hydrogen bond acceptor count of (Phenylcyclopropyl)methylamine hydrochloride?
The hydrogen bond acceptor count is 1.
Is (Phenylcyclopropyl)methylamine hydrochloride a canonicalized compound?
Yes, (Phenylcyclopropyl)methylamine hydrochloride is a canonicalized compound.