7-Bromo-4-fluoroindole

• CAS: 292636-09-0
• Catalog Number: ACM292636090
• Category: Bromine Series
• Molecular Weight: 214.03
• Molecular Formula: C8H5BrFN

Custom Q&A

What is the molecular formula of 7-Bromo-4-fluoroindole?

The molecular formula is C8H5BrFN.

What is the molecular weight of 7-Bromo-4-fluoroindole?

The molecular weight is 214.03 g/mol.

What is the IUPAC name of 7-Bromo-4-fluoroindole?

The IUPAC name is 7-bromo-4-fluoro-1H-indole.

What is the InChI of 7-Bromo-4-fluoroindole?

The InChI is InChI=1S/C8H5BrFN/c9-6-1-2-7(10)5-3-4-11-8(5)6/h1-4,11H.

What is the InChIKey of 7-Bromo-4-fluoroindole?

The InChIKey is PRXUTIXCOBFMMM-UHFFFAOYSA-N.

What is the canonical SMILES of 7-Bromo-4-fluoroindole?

The canonical SMILES is C1=CC(=C2C(=C1F)C=CN2)Br.

What is the XLogP3-AA value of 7-Bromo-4-fluoroindole?

The XLogP3-AA value is 2.8.

How many hydrogen bond donor count does 7-Bromo-4-fluoroindole have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor count does 7-Bromo-4-fluoroindole have?

It has 1 hydrogen bond acceptor count.

What is the topological polar surface area of 7-Bromo-4-fluoroindole?

The topological polar surface area is 15.8Ų.