3-Bromoacetylcoumarin

• CAS: 29310-88-1
• Catalog Number: ACM29310881
• Category: Bromine Series
• Molecular Weight: 267.07
• Molecular Formula: C₁₁H₇BrO₃

Custom Q&A

What is the PubChem CID for 3-Bromoacetylcoumarin?

The PubChem CID for 3-Bromoacetylcoumarin is 2063461.

What is the molecular formula of 3-Bromoacetylcoumarin?

The molecular formula of 3-Bromoacetylcoumarin is C11H7BrO3.

What is the molecular weight of 3-Bromoacetylcoumarin?

The molecular weight of 3-Bromoacetylcoumarin is 267.07 g/mol.

What is the IUPAC name of 3-Bromoacetylcoumarin?

The IUPAC name of 3-Bromoacetylcoumarin is 3-(2-bromoacetyl)chromen-2-one.

What is the InChIKey of 3-Bromoacetylcoumarin?

The InChIKey of 3-Bromoacetylcoumarin is NTYOLVNSXVYRTJ-UHFFFAOYSA-N.

What is the Canonical SMILES of 3-Bromoacetylcoumarin?

The Canonical SMILES of 3-Bromoacetylcoumarin is C1=CC=C2C(=C1)C=C(C(=O)O2)C(=O)CBr.

What is the CAS number of 3-Bromoacetylcoumarin?

The CAS number of 3-Bromoacetylcoumarin is 29310-88-1.

What is the XLogP3-AA value of 3-Bromoacetylcoumarin?

The XLogP3-AA value of 3-Bromoacetylcoumarin is 2.6.

What is the hydrogen bond acceptor count of 3-Bromoacetylcoumarin?

The hydrogen bond acceptor count of 3-Bromoacetylcoumarin is 3.

Is 3-Bromoacetylcoumarin a canonicalized compound?

Yes, 3-Bromoacetylcoumarin is a canonicalized compound.