6-Quinolinyl trifluoromethanesulfonate

• CAS: 173089-80-0
• Catalog Number: ACM173089800-1
• Category: Quinolines
• Molecular Weight: 277.22
• Molecular Formula: C10H6F3NO3S
• Melting Point: 34-38 °C(lit.)
• Appearance: White to Yellow; Crystal to Powder

Custom Q&A

What is the molecular formula of 6-Quinolinyl trifluoromethanesulfonate?

The molecular formula is C10H6F3NO3S.

What is the molecular weight of 6-Quinolinyl trifluoromethanesulfonate?

The molecular weight is 277.22 g/mol.

What is the IUPAC name of 6-Quinolinyl trifluoromethanesulfonate?

The IUPAC name is quinolin-6-yl trifluoromethanesulfonate.

What is the InChIKey of 6-Quinolinyl trifluoromethanesulfonate?

The InChIKey is TVYXNKUMLWUQPV-UHFFFAOYSA-N.

What is the Canonical SMILES of 6-Quinolinyl trifluoromethanesulfonate?

The Canonical SMILES is C1=CC2=C(C=CC(=C2)OS(=O)(=O)C(F)(F)F)N=C1.

What is the CAS number of 6-Quinolinyl trifluoromethanesulfonate?

The CAS number is 173089-80-0.

How many hydrogen bond donor counts does 6-Quinolinyl trifluoromethanesulfonate have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 6-Quinolinyl trifluoromethanesulfonate have?

It has 7 hydrogen bond acceptor counts.

What is the topological polar surface area of 6-Quinolinyl trifluoromethanesulfonate?

The topological polar surface area is 64.6 Ų.

Is 6-Quinolinyl trifluoromethanesulfonate a canonicalized compound?

Yes, it is a canonicalized compound.