4-Hydroxy-8-(trifluoromethyl)quinoline

• CAS: 23779-96-6
• Catalog Number: ACM23779966
• Category: Quinolines
• Molecular Weight: 213.16
• Molecular Formula: C10H6F3NO
• Melting Point: 174-176 °C(lit.

Custom Q&A

What is the molecular formula of 4-Hydroxy-8-(trifluoromethyl)quinoline?

The molecular formula is C10H6F3NO.

What is the molecular weight of 4-Hydroxy-8-(trifluoromethyl)quinoline?

The molecular weight is 213.16 g/mol.

What is the IUPAC name of 4-Hydroxy-8-(trifluoromethyl)quinoline?

The IUPAC name is 8-(trifluoromethyl)-1H-quinolin-4-one.

What is the InChI of 4-Hydroxy-8-(trifluoromethyl)quinoline?

The InChI is InChI=1S/C10H6F3NO/c11-10(12,13)7-3-1-2-6-8(15)4-5-14-9(6)7/h1-5H,(H,14,15).

What is the Canonical SMILES of 4-Hydroxy-8-(trifluoromethyl)quinoline?

The Canonical SMILES is C1=CC2=C(C(=C1)C(F)(F)F)NC=CC2=O.

What is the CAS number of 4-Hydroxy-8-(trifluoromethyl)quinoline?

The CAS number is 93919-57-4.

What is the ChEMBL ID of 4-Hydroxy-8-(trifluoromethyl)quinoline?

The ChEMBL ID is CHEMBL1530101.

What is the XLogP3-AA value of 4-Hydroxy-8-(trifluoromethyl)quinoline?

The XLogP3-AA value is 2.4.

How many hydrogen bond donor counts does 4-Hydroxy-8-(trifluoromethyl)quinoline have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 4-Hydroxy-8-(trifluoromethyl)quinoline have?

It has 5 hydrogen bond acceptor counts.