6-(Cyclobutylamino)pyridine-2-boronicacidpinacolester

• CAS: 1315350-34-5
• Catalog Number: ACM1315350345
• Category: Boronic Esters

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C15H23BN2O2.

What is the molecular weight of the compound?

The molecular weight of the compound is 274.17 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is N-cyclobutyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C15H23BN2O2/c1-14(2)15(3,4)20-16(19-14)12-9-6-10-13(18-12)17-11-7-5-8-11/h6,9-11H,5,7-8H2,1-4H3,(H,17,18).

What is the InChIKey of the compound?

The InChIKey of the compound is ISWNYJIAZWVVHV-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=NC(=CC=C2)NC3CCC3.

What is the CAS number of the compound?

The CAS number of the compound is 1315350-34-5.

What is the DSSTox Substance ID of the compound?

The DSSTox Substance ID of the compound is DTXSID30694456.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 1.

What is the hydrogen bond acceptor count of the compound?

The hydrogen bond acceptor count of the compound is 4.