6-Ethoxy-5-fluoropyridine-3-boronicacidpinacolester

• CAS: 1334167-86-0
• Catalog Number: ACM1334167860
• Category: Boronic Esters

Custom Q&A

What is the molecular formula of the compound with PubChem CID 69941664?

The molecular formula is C13H19BFNO3.

What is the molecular weight of the compound?

The molecular weight is 267.11 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 2-ethoxy-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.

What is the Canonical SMILES representation of the compound?

The Canonical SMILES representation is B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)OCC)F.

How many hydrogen bond acceptors does the compound have?

The compound has 5 hydrogen bond acceptors.

What is the exact mass and monoisotopic mass of the compound?

The exact mass and monoisotopic mass are both 267.1442018 g/mol.

What is the topological polar surface area of the compound?

The topological polar surface area is 40.6 Ų.

How many rotatable bonds does the compound have?

The compound has 3 rotatable bonds.

Is the compound a covalently-bonded unit?

Yes, the compound is a covalently-bonded unit.

When was the compound created and last modified in PubChem?

The compound was created on 2012-12-01 and last modified on 2023-12-02.