6-Bromo-7-nitro-1H-benzo[d]imidazole

• CAS: 281190-51-0
• Catalog Number: ACM281190510
• Category: Bromine Series
• Molecular Weight: 242.03
• Molecular Formula: C₇H₄BrN₃O₂
• Synonyms: 6-Bromo-7-nitro-1H-benzo[d]imidazole;5-bromo-4-nitro-1H-benzimidazole
• Density: 1.965g/cm³

Custom Q&A

What is the molecular formula of 6-Bromo-7-nitro-1H-benzo[d]imidazole?

The molecular formula is C7H4BrN3O2.

What is the molecular weight of 6-Bromo-7-nitro-1H-benzo[d]imidazole?

The molecular weight is 242.03 g/mol.

What is the IUPAC name of 6-Bromo-7-nitro-1H-benzo[d]imidazole?

The IUPAC name is 5-bromo-4-nitro-1H-benzimidazole.

What is the InChI of 6-Bromo-7-nitro-1H-benzo[d]imidazole?

The InChI is InChI=1S/C7H4BrN3O2/c8-4-1-2-5-6(10-3-9-5)7(4)11(12)13/h1-3H,(H,9,10).

What is the InChIKey of 6-Bromo-7-nitro-1H-benzo[d]imidazole?

The InChIKey is DIXVWNMTELJZIY-UHFFFAOYSA-N.

What is the Canonical SMILES of 6-Bromo-7-nitro-1H-benzo[d]imidazole?

The Canonical SMILES is C1=CC(=C(C2=C1NC=N2)[N+](=O)[O-])Br.

What is the CAS number of 6-Bromo-7-nitro-1H-benzo[d]imidazole?

The CAS number is 281190-51-0.

What is the XLogP3-AA value of 6-Bromo-7-nitro-1H-benzo[d]imidazole?

The XLogP3-AA value is 2.

How many hydrogen bond acceptors does 6-Bromo-7-nitro-1H-benzo[d]imidazole have?

It has 3 hydrogen bond acceptors.

Is 6-Bromo-7-nitro-1H-benzo[d]imidazole a canonicalized compound?

Yes, it is a canonicalized compound.