4-Bromo-1-naphthalenesulfonyl chloride

• CAS: 63279-36-7
• Catalog Number: ACM63279367
• Category: Bromine Series

Custom Q&A

What is the molecular formula of 4-Bromo-1-naphthalenesulfonyl chloride?

The molecular formula of 4-Bromo-1-naphthalenesulfonyl chloride is C10H6BrClO2S.

What is the molecular weight of 4-Bromo-1-naphthalenesulfonyl chloride?

The molecular weight of 4-Bromo-1-naphthalenesulfonyl chloride is 305.58 g/mol.

When was 4-Bromo-1-naphthalenesulfonyl chloride created?

4-Bromo-1-naphthalenesulfonyl chloride was created on July 19, 2005.

What is the IUPAC name of 4-Bromo-1-naphthalenesulfonyl chloride?

The IUPAC name of 4-Bromo-1-naphthalenesulfonyl chloride is 4-bromonaphthalene-1-sulfonyl chloride.

What is the InChIKey of 4-Bromo-1-naphthalenesulfonyl chloride?

The InChIKey of 4-Bromo-1-naphthalenesulfonyl chloride is MNBFYZPSEJKTFA-UHFFFAOYSA-N.

What is the Canonical SMILES of 4-Bromo-1-naphthalenesulfonyl chloride?

The Canonical SMILES of 4-Bromo-1-naphthalenesulfonyl chloride is C1=CC=C2C(=C1)C(=CC=C2Br)S(=O)(=O)Cl.

What is the CAS number of 4-Bromo-1-naphthalenesulfonyl chloride?

The CAS number of 4-Bromo-1-naphthalenesulfonyl chloride is 63279-36-7.

What is the XLogP3-AA value of 4-Bromo-1-naphthalenesulfonyl chloride?

The XLogP3-AA value of 4-Bromo-1-naphthalenesulfonyl chloride is 3.9.

How many hydrogen bond donor counts does 4-Bromo-1-naphthalenesulfonyl chloride have?

4-Bromo-1-naphthalenesulfonyl chloride has 0 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 4-Bromo-1-naphthalenesulfonyl chloride have?

4-Bromo-1-naphthalenesulfonyl chloride has 2 hydrogen bond acceptor counts.