6-Bromo-3-iodopyridin-2-amine

• CAS: 1245643-34-8
• Catalog Number: ACM1245643348
• Category: Pyridines
• Molecular Weight: 298.91
• Molecular Formula: C5H4BrIN2

Custom Q&A

What is the molecular formula of 6-Bromo-3-iodopyridin-2-amine?

The molecular formula is C5H4BrIN2.

What is the molecular weight of 6-Bromo-3-iodopyridin-2-amine?

The molecular weight is 298.91 g/mol.

What is the IUPAC name of 6-Bromo-3-iodopyridin-2-amine?

The IUPAC name is 6-bromo-3-iodopyridin-2-amine.

What is the InChI of 6-Bromo-3-iodopyridin-2-amine?

The InChI is InChI=1S/C5H4BrIN2/c6-4-2-1-3(7)5(8)9-4/h1-2H,(H2,8,9).

What is the InChIKey of 6-Bromo-3-iodopyridin-2-amine?

The InChIKey is HHQGRKKBXXFFFZ-UHFFFAOYSA-N.

What is the canonical SMILES of 6-Bromo-3-iodopyridin-2-amine?

The canonical SMILES is C1=CC(=NC(=C1I)N)Br.

What is the CAS number of 6-Bromo-3-iodopyridin-2-amine?

The CAS number is 1245643-34-8.

How many hydrogen bond donor counts does 6-Bromo-3-iodopyridin-2-amine have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 6-Bromo-3-iodopyridin-2-amine have?

It has 2 hydrogen bond acceptor counts.

How many rotatable bond counts does 6-Bromo-3-iodopyridin-2-amine have?

It has 0 rotatable bond counts.